C36H50FN — CID 118706716
(1R,2R,14R,17R,18R,21R,24R,25R,26R)-7-fluoro-2,13,13,17,18,21-hexamethyl-24-prop-1-en-2-yl-11-azaheptacyclo[15.11.0.02,14.04,12.05,10.018,26.021,25]octacosa-4(12),5(10),6,8-tetraene (PubChem CID 118706716) has the molecular formula C36H50FN and a molecular weight of 515.80 g/mol. Its IUPAC name is (1R,2R,14R,17R,18R,21R,24R,25R,26R)-7-fluoro-2,13,13,17,18,21-hexamethyl-24-prop-1-en-2-yl-11-azaheptacyclo[15.11.0.02,14.04,12.05,10.018,26.021,25]octacosa-4(12),5(10),6,8-tetraene.
| Compound Name | (1R,2R,14R,17R,18R,21R,24R,25R,26R)-7-fluoro-2,13,13,17,18,21-hexamethyl-24-prop-1-en-2-yl-11-azaheptacyclo[15.11.0.02,14.04,12.05,10.018,26.021,25]octacosa-4(12),5(10),6,8-tetraene |
|---|---|
| PubChem CID | 118706716 |
| Molecular Formula | C36H50FN |
| Molecular Weight | 515.80 g/mol |
| Exact Mass | 515.39 |
| IUPAC Name | (1R,2R,14R,17R,18R,21R,24R,25R,26R)-7-fluoro-2,13,13,17,18,21-hexamethyl-24-prop-1-en-2-yl-11-azaheptacyclo[15.11.0.02,14.04,12.05,10.018,26.021,25]octacosa-4(12),5(10),6,8-tetraene |
| SMILES | C=C(C)[C@@H]1CC[C@]2(C)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)Cc6c([nH]c7ccc(F)cc67)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
| InChI | InChI=1S/C36H50FN/c1-21(2)23-13-15-33(5)17-18-35(7)26(30(23)33)10-12-29-34(6)20-25-24-19-22(37)9-11-27(24)38-31(25)32(3,4)28(34)14-16-36(29,35)8/h9,11,19,23,26,28-30,38H,1,10,12-18,20H2,2-8H3/t23-,26+,28-,29+,30+,33+,34-,35+,36+/m0/s1 |
| InChIKey | KOEKIOQRIZPVMP-SPUVNAPJSA-N |
| XLogP | 10.00 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.80 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|