C21H20N2O3 — CID 118706720
2-[[(4S)-6,6-dimethyl-4-phenyl-4,5-dihydrooxazin-3-yl]methyl]isoindole-1,3-dione (PubChem CID 118706720) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-[[(4S)-6,6-dimethyl-4-phenyl-4,5-dihydrooxazin-3-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[(4S)-6,6-dimethyl-4-phenyl-4,5-dihydrooxazin-3-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 118706720 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 2-[[(4S)-6,6-dimethyl-4-phenyl-4,5-dihydrooxazin-3-yl]methyl]isoindole-1,3-dione |
| SMILES | CC1(C)C[C@@H](c2ccccc2)C(CN2C(=O)c3ccccc3C2=O)=NO1 |
| InChI | InChI=1S/C21H20N2O3/c1-21(2)12-17(14-8-4-3-5-9-14)18(22-26-21)13-23-19(24)15-10-6-7-11-16(15)20(23)25/h3-11,17H,12-13H2,1-2H3/t17-/m0/s1 |
| InChIKey | NGUXCXJIKRXBDI-KRWDZBQOSA-N |
| XLogP | 3.62 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|