About 5-(2-methoxyphenyl)-5-methyl-2-(phenoxymethyl)-6,7-dihydropyrazolo[1,5-a]pyridin-4-one
5-(2-methoxyphenyl)-5-methyl-2-(phenoxymethyl)-6,7-dihydropyrazolo[1,5-a]pyridin-4-one (PubChem CID 118706761) has the molecular formula C22H22N2O3
and a molecular weight of 362.43 g/mol. Its IUPAC name is 5-(2-methoxyphenyl)-5-methyl-2-(phenoxymethyl)-6,7-dihydropyrazolo[1,5-a]pyridin-4-one.
Molecular Properties
| Compound Name | 5-(2-methoxyphenyl)-5-methyl-2-(phenoxymethyl)-6,7-dihydropyrazolo[1,5-a]pyridin-4-one |
| PubChem CID | 118706761 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 5-(2-methoxyphenyl)-5-methyl-2-(phenoxymethyl)-6,7-dihydropyrazolo[1,5-a]pyridin-4-one |
| SMILES | COc1ccccc1C1(C)CCn2nc(COc3ccccc3)cc2C1=O |
| InChI | InChI=1S/C22H22N2O3/c1-22(18-10-6-7-11-20(18)26-2)12-13-24-19(21(22)25)14-16(23-24)15-27-17-8-4-3-5-9-17/h3-11,14H,12-13,15H2,1-2H3 |
| InChIKey | NDYXDJVELNSTTR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(2-methoxyphenyl)-5-methyl-2-(phenoxymethyl)-6,7-dihydropyrazolo[1,5-a]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methoxyphenyl)-5-methyl-2-(phenoxymethyl)-6,7-dihydropyrazolo[1,5-a]pyridin-4-one?
The IUPAC name of 5-(2-methoxyphenyl)-5-methyl-2-(phenoxymethyl)-6,7-dihydropyrazolo[1,5-a]pyridin-4-one (CID 118706761) is 5-(2-methoxyphenyl)-5-methyl-2-(phenoxymethyl)-6,7-dihydropyrazolo[1,5-a]pyridin-4-one.
What is the SMILES notation for 5-(2-methoxyphenyl)-5-methyl-2-(phenoxymethyl)-6,7-dihydropyrazolo[1,5-a]pyridin-4-one?
The canonical SMILES for 5-(2-methoxyphenyl)-5-methyl-2-(phenoxymethyl)-6,7-dihydropyrazolo[1,5-a]pyridin-4-one is COc1ccccc1C1(C)CCn2nc(COc3ccccc3)cc2C1=O.
What is the InChIKey of 5-(2-methoxyphenyl)-5-methyl-2-(phenoxymethyl)-6,7-dihydropyrazolo[1,5-a]pyridin-4-one?
The InChIKey is NDYXDJVELNSTTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N2O3/c1-22(18-10-6-7-11-20(18)26-2)12-13-24-19(21(22)25)14-16(23-24)15-27-17-8-4-3-5-9-17/h3-11,14H,12-13,15H2,1-2H3.
What are the key properties of 5-(2-methoxyphenyl)-5-methyl-2-(phenoxymethyl)-6,7-dihydropyrazolo[1,5-a]pyridin-4-one?
5-(2-methoxyphenyl)-5-methyl-2-(phenoxymethyl)-6,7-dihydropyrazolo[1,5-a]pyridin-4-one has a molecular weight of 362.43 g/mol, XLogP of 4.01, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methoxyphenyl)-5-methyl-2-(phenoxymethyl)-6,7-dihydropyrazolo[1,5-a]pyridin-4-one is sourced from PubChem (CID 118706761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).