C13H15NO5S — CID 118706863
(5aR,6S,7S,8R,9S)-6,7,8-trihydroxy-9-(hydroxymethyl)-6,7,8,9-tetrahydro-5aH-pyrido[2,1-b][1,3]benzothiazin-11-one (PubChem CID 118706863) has the molecular formula C13H15NO5S and a molecular weight of 297.33 g/mol. Its IUPAC name is (5aR,6S,7S,8R,9S)-6,7,8-trihydroxy-9-(hydroxymethyl)-6,7,8,9-tetrahydro-5aH-pyrido[2,1-b][1,3]benzothiazin-11-one.
| Compound Name | (5aR,6S,7S,8R,9S)-6,7,8-trihydroxy-9-(hydroxymethyl)-6,7,8,9-tetrahydro-5aH-pyrido[2,1-b][1,3]benzothiazin-11-one |
|---|---|
| PubChem CID | 118706863 |
| Molecular Formula | C13H15NO5S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | (5aR,6S,7S,8R,9S)-6,7,8-trihydroxy-9-(hydroxymethyl)-6,7,8,9-tetrahydro-5aH-pyrido[2,1-b][1,3]benzothiazin-11-one |
| SMILES | O=C1c2ccccc2S[C@@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@H](CO)N12 |
| InChI | InChI=1S/C13H15NO5S/c15-5-7-9(16)10(17)11(18)13-14(7)12(19)6-3-1-2-4-8(6)20-13/h1-4,7,9-11,13,15-18H,5H2/t7-,9+,10-,11-,13+/m0/s1 |
| InChIKey | RZDAPPSQQVAYNK-HIEHBEHPSA-N |
| XLogP | -0.98 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |