C30H27N5O — CID 118707015
6-(1,4,5,6-tetrahydropyrimidin-2-yl)-2-[4-[5-(1,4,5,6-tetrahydropyrimidin-2-yl)-1-benzofuran-2-yl]phenyl]-1H-indole (PubChem CID 118707015) has the molecular formula C30H27N5O and a molecular weight of 473.58 g/mol. Its IUPAC name is 6-(1,4,5,6-tetrahydropyrimidin-2-yl)-2-[4-[5-(1,4,5,6-tetrahydropyrimidin-2-yl)-1-benzofuran-2-yl]phenyl]-1H-indole.
| Compound Name | 6-(1,4,5,6-tetrahydropyrimidin-2-yl)-2-[4-[5-(1,4,5,6-tetrahydropyrimidin-2-yl)-1-benzofuran-2-yl]phenyl]-1H-indole |
|---|---|
| PubChem CID | 118707015 |
| Molecular Formula | C30H27N5O |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 6-(1,4,5,6-tetrahydropyrimidin-2-yl)-2-[4-[5-(1,4,5,6-tetrahydropyrimidin-2-yl)-1-benzofuran-2-yl]phenyl]-1H-indole |
| SMILES | c1cc2oc(-c3ccc(-c4cc5ccc(C6=NCCCN6)cc5[nH]4)cc3)cc2cc1C1=NCCCN1 |
| InChI | InChI=1S/C30H27N5O/c1-11-31-29(32-12-1)22-9-10-27-24(15-22)18-28(36-27)20-5-3-19(4-6-20)25-16-21-7-8-23(17-26(21)35-25)30-33-13-2-14-34-30/h3-10,15-18,35H,1-2,11-14H2,(H,31,32)(H,33,34) |
| InChIKey | UWBWRBQXWGFBMY-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 77.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |