About N-(4-chloro-2,6-dimethylphenyl)-4-methoxybenzenesulfonamide
N-(4-chloro-2,6-dimethylphenyl)-4-methoxybenzenesulfonamide (PubChem CID 118707083) has the molecular formula C15H16ClNO3S
and a molecular weight of 325.82 g/mol. Its IUPAC name is N-(4-chloro-2,6-dimethylphenyl)-4-methoxybenzenesulfonamide.
Molecular Properties
| Compound Name | N-(4-chloro-2,6-dimethylphenyl)-4-methoxybenzenesulfonamide |
| PubChem CID | 118707083 |
| Molecular Formula | C15H16ClNO3S |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | N-(4-chloro-2,6-dimethylphenyl)-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2c(C)cc(Cl)cc2C)cc1 |
| InChI | InChI=1S/C15H16ClNO3S/c1-10-8-12(16)9-11(2)15(10)17-21(18,19)14-6-4-13(20-3)5-7-14/h4-9,17H,1-3H3 |
| InChIKey | NQRHYCHKCJXYEJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-chloro-2,6-dimethylphenyl)-4-methoxybenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-chloro-2,6-dimethylphenyl)-4-methoxybenzenesulfonamide?
The IUPAC name of N-(4-chloro-2,6-dimethylphenyl)-4-methoxybenzenesulfonamide (CID 118707083) is N-(4-chloro-2,6-dimethylphenyl)-4-methoxybenzenesulfonamide.
What is the SMILES notation for N-(4-chloro-2,6-dimethylphenyl)-4-methoxybenzenesulfonamide?
The canonical SMILES for N-(4-chloro-2,6-dimethylphenyl)-4-methoxybenzenesulfonamide is COc1ccc(S(=O)(=O)Nc2c(C)cc(Cl)cc2C)cc1.
What is the InChIKey of N-(4-chloro-2,6-dimethylphenyl)-4-methoxybenzenesulfonamide?
The InChIKey is NQRHYCHKCJXYEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16ClNO3S/c1-10-8-12(16)9-11(2)15(10)17-21(18,19)14-6-4-13(20-3)5-7-14/h4-9,17H,1-3H3.
What are the key properties of N-(4-chloro-2,6-dimethylphenyl)-4-methoxybenzenesulfonamide?
N-(4-chloro-2,6-dimethylphenyl)-4-methoxybenzenesulfonamide has a molecular weight of 325.82 g/mol, XLogP of 3.77, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-chloro-2,6-dimethylphenyl)-4-methoxybenzenesulfonamide is sourced from PubChem (CID 118707083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).