About 4-[(4-methoxyphenyl)sulfonylamino]-3,5-dimethylbenzoic acid
4-[(4-methoxyphenyl)sulfonylamino]-3,5-dimethylbenzoic acid (PubChem CID 118707086) has the molecular formula C16H17NO5S
and a molecular weight of 335.38 g/mol. Its IUPAC name is 4-[(4-methoxyphenyl)sulfonylamino]-3,5-dimethylbenzoic acid.
Molecular Properties
| Compound Name | 4-[(4-methoxyphenyl)sulfonylamino]-3,5-dimethylbenzoic acid |
| PubChem CID | 118707086 |
| Molecular Formula | C16H17NO5S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 4-[(4-methoxyphenyl)sulfonylamino]-3,5-dimethylbenzoic acid |
| SMILES | COc1ccc(S(=O)(=O)Nc2c(C)cc(C(=O)O)cc2C)cc1 |
| InChI | InChI=1S/C16H17NO5S/c1-10-8-12(16(18)19)9-11(2)15(10)17-23(20,21)14-6-4-13(22-3)5-7-14/h4-9,17H,1-3H3,(H,18,19) |
| InChIKey | WXVOVPNOXACPAD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(4-methoxyphenyl)sulfonylamino]-3,5-dimethylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-methoxyphenyl)sulfonylamino]-3,5-dimethylbenzoic acid?
The IUPAC name of 4-[(4-methoxyphenyl)sulfonylamino]-3,5-dimethylbenzoic acid (CID 118707086) is 4-[(4-methoxyphenyl)sulfonylamino]-3,5-dimethylbenzoic acid.
What is the SMILES notation for 4-[(4-methoxyphenyl)sulfonylamino]-3,5-dimethylbenzoic acid?
The canonical SMILES for 4-[(4-methoxyphenyl)sulfonylamino]-3,5-dimethylbenzoic acid is COc1ccc(S(=O)(=O)Nc2c(C)cc(C(=O)O)cc2C)cc1.
What is the InChIKey of 4-[(4-methoxyphenyl)sulfonylamino]-3,5-dimethylbenzoic acid?
The InChIKey is WXVOVPNOXACPAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO5S/c1-10-8-12(16(18)19)9-11(2)15(10)17-23(20,21)14-6-4-13(22-3)5-7-14/h4-9,17H,1-3H3,(H,18,19).
What are the key properties of 4-[(4-methoxyphenyl)sulfonylamino]-3,5-dimethylbenzoic acid?
4-[(4-methoxyphenyl)sulfonylamino]-3,5-dimethylbenzoic acid has a molecular weight of 335.38 g/mol, XLogP of 2.81, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-methoxyphenyl)sulfonylamino]-3,5-dimethylbenzoic acid is sourced from PubChem (CID 118707086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).