About N-(2,6-dimethyl-4-prop-2-enylphenyl)-4-methoxybenzenesulfonamide
N-(2,6-dimethyl-4-prop-2-enylphenyl)-4-methoxybenzenesulfonamide (PubChem CID 118707173) has the molecular formula C18H21NO3S
and a molecular weight of 331.44 g/mol. Its IUPAC name is N-(2,6-dimethyl-4-prop-2-enylphenyl)-4-methoxybenzenesulfonamide.
Molecular Properties
| Compound Name | N-(2,6-dimethyl-4-prop-2-enylphenyl)-4-methoxybenzenesulfonamide |
| PubChem CID | 118707173 |
| Molecular Formula | C18H21NO3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | N-(2,6-dimethyl-4-prop-2-enylphenyl)-4-methoxybenzenesulfonamide |
| SMILES | C=CCc1cc(C)c(NS(=O)(=O)c2ccc(OC)cc2)c(C)c1 |
| InChI | InChI=1S/C18H21NO3S/c1-5-6-15-11-13(2)18(14(3)12-15)19-23(20,21)17-9-7-16(22-4)8-10-17/h5,7-12,19H,1,6H2,2-4H3 |
| InChIKey | KUKDUKQYCZLUPL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(2,6-dimethyl-4-prop-2-enylphenyl)-4-methoxybenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,6-dimethyl-4-prop-2-enylphenyl)-4-methoxybenzenesulfonamide?
The IUPAC name of N-(2,6-dimethyl-4-prop-2-enylphenyl)-4-methoxybenzenesulfonamide (CID 118707173) is N-(2,6-dimethyl-4-prop-2-enylphenyl)-4-methoxybenzenesulfonamide.
What is the SMILES notation for N-(2,6-dimethyl-4-prop-2-enylphenyl)-4-methoxybenzenesulfonamide?
The canonical SMILES for N-(2,6-dimethyl-4-prop-2-enylphenyl)-4-methoxybenzenesulfonamide is C=CCc1cc(C)c(NS(=O)(=O)c2ccc(OC)cc2)c(C)c1.
What is the InChIKey of N-(2,6-dimethyl-4-prop-2-enylphenyl)-4-methoxybenzenesulfonamide?
The InChIKey is KUKDUKQYCZLUPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO3S/c1-5-6-15-11-13(2)18(14(3)12-15)19-23(20,21)17-9-7-16(22-4)8-10-17/h5,7-12,19H,1,6H2,2-4H3.
What are the key properties of N-(2,6-dimethyl-4-prop-2-enylphenyl)-4-methoxybenzenesulfonamide?
N-(2,6-dimethyl-4-prop-2-enylphenyl)-4-methoxybenzenesulfonamide has a molecular weight of 331.44 g/mol, XLogP of 3.84, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-dimethyl-4-prop-2-enylphenyl)-4-methoxybenzenesulfonamide is sourced from PubChem (CID 118707173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).