C21H27NO2 — CID 118707511
2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]prop-2-enyl pyridine-4-carboxylate (PubChem CID 118707511) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is 2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]prop-2-enyl pyridine-4-carboxylate.
| Compound Name | 2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]prop-2-enyl pyridine-4-carboxylate |
|---|---|
| PubChem CID | 118707511 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]prop-2-enyl pyridine-4-carboxylate |
| SMILES | C=C[C@]1(C)CC[C@@H](C(=C)COC(=O)c2ccncc2)C[C@H]1C(=C)C |
| InChI | InChI=1S/C21H27NO2/c1-6-21(5)10-7-18(13-19(21)15(2)3)16(4)14-24-20(23)17-8-11-22-12-9-17/h6,8-9,11-12,18-19H,1-2,4,7,10,13-14H2,3,5H3/t18-,19+,21-/m1/s1 |
| InChIKey | PCYDSOZWKUQKSQ-SVFBPWRDSA-N |
| XLogP | 4.98 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|