About 5-[(E)-2-(2,6-difluorophenyl)ethenyl]-N-methylpyridin-2-amine
5-[(E)-2-(2,6-difluorophenyl)ethenyl]-N-methylpyridin-2-amine (PubChem CID 118707600) has the molecular formula C14H12F2N2
and a molecular weight of 246.26 g/mol. Its IUPAC name is 5-[(E)-2-(2,6-difluorophenyl)ethenyl]-N-methylpyridin-2-amine.
Molecular Properties
| Compound Name | 5-[(E)-2-(2,6-difluorophenyl)ethenyl]-N-methylpyridin-2-amine |
| PubChem CID | 118707600 |
| Molecular Formula | C14H12F2N2 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 5-[(E)-2-(2,6-difluorophenyl)ethenyl]-N-methylpyridin-2-amine |
| SMILES | CNc1ccc(/C=C/c2c(F)cccc2F)cn1 |
| InChI | InChI=1S/C14H12F2N2/c1-17-14-8-6-10(9-18-14)5-7-11-12(15)3-2-4-13(11)16/h2-9H,1H3,(H,17,18)/b7-5+ |
| InChIKey | GTUIFCYUYIHSEQ-FNORWQNLSA-N |
| XLogP | 3.57 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(E)-2-(2,6-difluorophenyl)ethenyl]-N-methylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-2-(2,6-difluorophenyl)ethenyl]-N-methylpyridin-2-amine?
The IUPAC name of 5-[(E)-2-(2,6-difluorophenyl)ethenyl]-N-methylpyridin-2-amine (CID 118707600) is 5-[(E)-2-(2,6-difluorophenyl)ethenyl]-N-methylpyridin-2-amine.
What is the SMILES notation for 5-[(E)-2-(2,6-difluorophenyl)ethenyl]-N-methylpyridin-2-amine?
The canonical SMILES for 5-[(E)-2-(2,6-difluorophenyl)ethenyl]-N-methylpyridin-2-amine is CNc1ccc(/C=C/c2c(F)cccc2F)cn1.
What is the InChIKey of 5-[(E)-2-(2,6-difluorophenyl)ethenyl]-N-methylpyridin-2-amine?
The InChIKey is GTUIFCYUYIHSEQ-FNORWQNLSA-N. The full InChI is InChI=1S/C14H12F2N2/c1-17-14-8-6-10(9-18-14)5-7-11-12(15)3-2-4-13(11)16/h2-9H,1H3,(H,17,18)/b7-5+.
What are the key properties of 5-[(E)-2-(2,6-difluorophenyl)ethenyl]-N-methylpyridin-2-amine?
5-[(E)-2-(2,6-difluorophenyl)ethenyl]-N-methylpyridin-2-amine has a molecular weight of 246.26 g/mol, XLogP of 3.57, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-2-(2,6-difluorophenyl)ethenyl]-N-methylpyridin-2-amine is sourced from PubChem (CID 118707600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).