C23H24O7S — CID 118707692
(3E,5Z)-3,5-bis[(3,4-dimethoxyphenyl)methylidene]-1,1-dioxothian-4-one (PubChem CID 118707692) has the molecular formula C23H24O7S and a molecular weight of 444.51 g/mol. Its IUPAC name is (3E,5Z)-3,5-bis[(3,4-dimethoxyphenyl)methylidene]-1,1-dioxothian-4-one.
| Compound Name | (3E,5Z)-3,5-bis[(3,4-dimethoxyphenyl)methylidene]-1,1-dioxothian-4-one |
|---|---|
| PubChem CID | 118707692 |
| Molecular Formula | C23H24O7S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | (3E,5Z)-3,5-bis[(3,4-dimethoxyphenyl)methylidene]-1,1-dioxothian-4-one |
| SMILES | COc1ccc(/C=C2\CS(=O)(=O)C/C(=C/c3ccc(OC)c(OC)c3)C2=O)cc1OC |
| InChI | InChI=1S/C23H24O7S/c1-27-19-7-5-15(11-21(19)29-3)9-17-13-31(25,26)14-18(23(17)24)10-16-6-8-20(28-2)22(12-16)30-4/h5-12H,13-14H2,1-4H3/b17-9-,18-10+ |
| InChIKey | PSZOCNZHVICBQL-BUOZRGFLSA-N |
| XLogP | 3.19 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|