About 8-hydroxy-4,9-dioxobenzo[f][1]benzothiole-2-carboxylic acid
8-hydroxy-4,9-dioxobenzo[f][1]benzothiole-2-carboxylic acid (PubChem CID 118707762) has the molecular formula C13H6O5S
and a molecular weight of 274.25 g/mol. Its IUPAC name is 8-hydroxy-4,9-dioxobenzo[f][1]benzothiole-2-carboxylic acid.
Molecular Properties
| Compound Name | 8-hydroxy-4,9-dioxobenzo[f][1]benzothiole-2-carboxylic acid |
| PubChem CID | 118707762 |
| Molecular Formula | C13H6O5S |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | 8-hydroxy-4,9-dioxobenzo[f][1]benzothiole-2-carboxylic acid |
| SMILES | O=C(O)c1cc2c(s1)C(=O)c1c(O)cccc1C2=O |
| InChI | InChI=1S/C13H6O5S/c14-7-3-1-2-5-9(7)11(16)12-6(10(5)15)4-8(19-12)13(17)18/h1-4,14H,(H,17,18) |
| InChIKey | GSLAWECGRIERFE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 8-hydroxy-4,9-dioxobenzo[f][1]benzothiole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hydroxy-4,9-dioxobenzo[f][1]benzothiole-2-carboxylic acid?
The IUPAC name of 8-hydroxy-4,9-dioxobenzo[f][1]benzothiole-2-carboxylic acid (CID 118707762) is 8-hydroxy-4,9-dioxobenzo[f][1]benzothiole-2-carboxylic acid.
What is the SMILES notation for 8-hydroxy-4,9-dioxobenzo[f][1]benzothiole-2-carboxylic acid?
The canonical SMILES for 8-hydroxy-4,9-dioxobenzo[f][1]benzothiole-2-carboxylic acid is O=C(O)c1cc2c(s1)C(=O)c1c(O)cccc1C2=O.
What is the InChIKey of 8-hydroxy-4,9-dioxobenzo[f][1]benzothiole-2-carboxylic acid?
The InChIKey is GSLAWECGRIERFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6O5S/c14-7-3-1-2-5-9(7)11(16)12-6(10(5)15)4-8(19-12)13(17)18/h1-4,14H,(H,17,18).
What are the key properties of 8-hydroxy-4,9-dioxobenzo[f][1]benzothiole-2-carboxylic acid?
8-hydroxy-4,9-dioxobenzo[f][1]benzothiole-2-carboxylic acid has a molecular weight of 274.25 g/mol, XLogP of 1.93, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydroxy-4,9-dioxobenzo[f][1]benzothiole-2-carboxylic acid is sourced from PubChem (CID 118707762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).