C15H14Cl2N2O4 — CID 118707986
N-(3,5-dichloro-4-pyridinyl)-2,3,4-trimethoxybenzamide (PubChem CID 118707986) has the molecular formula C15H14Cl2N2O4 and a molecular weight of 357.19 g/mol. Its IUPAC name is N-(3,5-dichloro-4-pyridinyl)-2,3,4-trimethoxybenzamide.
| Compound Name | N-(3,5-dichloro-4-pyridinyl)-2,3,4-trimethoxybenzamide |
|---|---|
| PubChem CID | 118707986 |
| Molecular Formula | C15H14Cl2N2O4 |
| Molecular Weight | 357.19 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | N-(3,5-dichloro-4-pyridinyl)-2,3,4-trimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2c(Cl)cncc2Cl)c(OC)c1OC |
| InChI | InChI=1S/C15H14Cl2N2O4/c1-21-11-5-4-8(13(22-2)14(11)23-3)15(20)19-12-9(16)6-18-7-10(12)17/h4-7H,1-3H3,(H,18,19,20) |
| InChIKey | UZPDIDQXBHSLFB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.19 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |