About 2-phenylpyrazolo[4,3-d]pyrimidin-7-amine
2-phenylpyrazolo[4,3-d]pyrimidin-7-amine (PubChem CID 118708214) has the molecular formula C11H9N5
and a molecular weight of 211.23 g/mol. Its IUPAC name is 2-phenylpyrazolo[4,3-d]pyrimidin-7-amine.
Molecular Properties
| Compound Name | 2-phenylpyrazolo[4,3-d]pyrimidin-7-amine |
| PubChem CID | 118708214 |
| Molecular Formula | C11H9N5 |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 2-phenylpyrazolo[4,3-d]pyrimidin-7-amine |
| SMILES | Nc1ncnc2cn(-c3ccccc3)nc12 |
| InChI | InChI=1S/C11H9N5/c12-11-10-9(13-7-14-11)6-16(15-10)8-4-2-1-3-5-8/h1-7H,(H2,12,13,14) |
| InChIKey | COEIPYGQWWKYSZ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-phenylpyrazolo[4,3-d]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylpyrazolo[4,3-d]pyrimidin-7-amine?
The IUPAC name of 2-phenylpyrazolo[4,3-d]pyrimidin-7-amine (CID 118708214) is 2-phenylpyrazolo[4,3-d]pyrimidin-7-amine.
What is the SMILES notation for 2-phenylpyrazolo[4,3-d]pyrimidin-7-amine?
The canonical SMILES for 2-phenylpyrazolo[4,3-d]pyrimidin-7-amine is Nc1ncnc2cn(-c3ccccc3)nc12.
What is the InChIKey of 2-phenylpyrazolo[4,3-d]pyrimidin-7-amine?
The InChIKey is COEIPYGQWWKYSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N5/c12-11-10-9(13-7-14-11)6-16(15-10)8-4-2-1-3-5-8/h1-7H,(H2,12,13,14).
What are the key properties of 2-phenylpyrazolo[4,3-d]pyrimidin-7-amine?
2-phenylpyrazolo[4,3-d]pyrimidin-7-amine has a molecular weight of 211.23 g/mol, XLogP of 1.40, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylpyrazolo[4,3-d]pyrimidin-7-amine is sourced from PubChem (CID 118708214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).