C16H22N4O6S3 — CID 118708307
4-[2-[2-(4-sulfamoylphenyl)ethylsulfamoylamino]ethyl]benzenesulfonamide (PubChem CID 118708307) has the molecular formula C16H22N4O6S3 and a molecular weight of 462.58 g/mol. Its IUPAC name is 4-[2-[2-(4-sulfamoylphenyl)ethylsulfamoylamino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[2-(4-sulfamoylphenyl)ethylsulfamoylamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 118708307 |
| Molecular Formula | C16H22N4O6S3 |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 4-[2-[2-(4-sulfamoylphenyl)ethylsulfamoylamino]ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCNS(=O)(=O)NCCc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C16H22N4O6S3/c17-27(21,22)15-5-1-13(2-6-15)9-11-19-29(25,26)20-12-10-14-3-7-16(8-4-14)28(18,23)24/h1-8,19-20H,9-12H2,(H2,17,21,22)(H2,18,23,24) |
| InChIKey | BEQUJZQUHTXZQK-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 178.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |