C15H11NOS — CID 118708376
1-(3-phenylthieno[2,3-b]pyridin-2-yl)ethanone (PubChem CID 118708376) has the molecular formula C15H11NOS and a molecular weight of 253.33 g/mol. Its IUPAC name is 1-(3-phenylthieno[2,3-b]pyridin-2-yl)ethanone.
| Compound Name | 1-(3-phenylthieno[2,3-b]pyridin-2-yl)ethanone |
|---|---|
| PubChem CID | 118708376 |
| Molecular Formula | C15H11NOS |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 1-(3-phenylthieno[2,3-b]pyridin-2-yl)ethanone |
| SMILES | CC(=O)c1sc2ncccc2c1-c1ccccc1 |
| InChI | InChI=1S/C15H11NOS/c1-10(17)14-13(11-6-3-2-4-7-11)12-8-5-9-16-15(12)18-14/h2-9H,1H3 |
| InChIKey | NHXYTMBHYAYFLR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |