C26H40O9 — CID 118708459
(2E)-6-[(2S,3R,4S,5R,6S)-6-[(6E)-7-carboxy-3-methylocta-1,6-dien-3-yl]oxy-4,5-dihydroxy-2-methyloxan-3-yl]oxy-2,6-dimethylocta-2,7-dienoic acid (PubChem CID 118708459) has the molecular formula C26H40O9 and a molecular weight of 496.60 g/mol. Its IUPAC name is (2E)-6-[(2S,3R,4S,5R,6S)-6-[(6E)-7-carboxy-3-methylocta-1,6-dien-3-yl]oxy-4,5-dihydroxy-2-methyloxan-3-yl]oxy-2,6-dimethylocta-2,7-dienoic acid.
| Compound Name | (2E)-6-[(2S,3R,4S,5R,6S)-6-[(6E)-7-carboxy-3-methylocta-1,6-dien-3-yl]oxy-4,5-dihydroxy-2-methyloxan-3-yl]oxy-2,6-dimethylocta-2,7-dienoic acid |
|---|---|
| PubChem CID | 118708459 |
| Molecular Formula | C26H40O9 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | (2E)-6-[(2S,3R,4S,5R,6S)-6-[(6E)-7-carboxy-3-methylocta-1,6-dien-3-yl]oxy-4,5-dihydroxy-2-methyloxan-3-yl]oxy-2,6-dimethylocta-2,7-dienoic acid |
| SMILES | C=CC(C)(CC/C=C(\C)C(=O)O)O[C@@H]1O[C@@H](C)[C@H](OC(C)(C=C)CC/C=C(\C)C(=O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C26H40O9/c1-8-25(6,14-10-12-16(3)22(29)30)34-21-18(5)33-24(20(28)19(21)27)35-26(7,9-2)15-11-13-17(4)23(31)32/h8-9,12-13,18-21,24,27-28H,1-2,10-11,14-15H2,3-7H3,(H,29,30)(H,31,32)/b16-12+,17-13+/t18-,19-,20+,21-,24-,25?,26?/m0/s1 |
| InChIKey | SJWYHZLOBXFSAN-UZMJDOMCSA-N |
| XLogP | 3.37 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|