About N-(2-fluoro-4-pyridin-3-ylphenyl)-2,3,4-trimethoxybenzamide
N-(2-fluoro-4-pyridin-3-ylphenyl)-2,3,4-trimethoxybenzamide (PubChem CID 118708514) has the molecular formula C21H19FN2O4
and a molecular weight of 382.39 g/mol. Its IUPAC name is N-(2-fluoro-4-pyridin-3-ylphenyl)-2,3,4-trimethoxybenzamide.
Molecular Properties
| Compound Name | N-(2-fluoro-4-pyridin-3-ylphenyl)-2,3,4-trimethoxybenzamide |
| PubChem CID | 118708514 |
| Molecular Formula | C21H19FN2O4 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | N-(2-fluoro-4-pyridin-3-ylphenyl)-2,3,4-trimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(-c3cccnc3)cc2F)c(OC)c1OC |
| InChI | InChI=1S/C21H19FN2O4/c1-26-18-9-7-15(19(27-2)20(18)28-3)21(25)24-17-8-6-13(11-16(17)22)14-5-4-10-23-12-14/h4-12H,1-3H3,(H,24,25) |
| InChIKey | YUKAHJKGUHIFIQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2-fluoro-4-pyridin-3-ylphenyl)-2,3,4-trimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-fluoro-4-pyridin-3-ylphenyl)-2,3,4-trimethoxybenzamide?
The IUPAC name of N-(2-fluoro-4-pyridin-3-ylphenyl)-2,3,4-trimethoxybenzamide (CID 118708514) is N-(2-fluoro-4-pyridin-3-ylphenyl)-2,3,4-trimethoxybenzamide.
What is the SMILES notation for N-(2-fluoro-4-pyridin-3-ylphenyl)-2,3,4-trimethoxybenzamide?
The canonical SMILES for N-(2-fluoro-4-pyridin-3-ylphenyl)-2,3,4-trimethoxybenzamide is COc1ccc(C(=O)Nc2ccc(-c3cccnc3)cc2F)c(OC)c1OC.
What is the InChIKey of N-(2-fluoro-4-pyridin-3-ylphenyl)-2,3,4-trimethoxybenzamide?
The InChIKey is YUKAHJKGUHIFIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19FN2O4/c1-26-18-9-7-15(19(27-2)20(18)28-3)21(25)24-17-8-6-13(11-16(17)22)14-5-4-10-23-12-14/h4-12H,1-3H3,(H,24,25).
What are the key properties of N-(2-fluoro-4-pyridin-3-ylphenyl)-2,3,4-trimethoxybenzamide?
N-(2-fluoro-4-pyridin-3-ylphenyl)-2,3,4-trimethoxybenzamide has a molecular weight of 382.39 g/mol, XLogP of 4.17, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-fluoro-4-pyridin-3-ylphenyl)-2,3,4-trimethoxybenzamide is sourced from PubChem (CID 118708514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).