About 3-methylidene-4,5-bis(2-phenylethyl)oxolan-2-one
3-methylidene-4,5-bis(2-phenylethyl)oxolan-2-one (PubChem CID 118708712) has the molecular formula C21H22O2
and a molecular weight of 306.41 g/mol. Its IUPAC name is 3-methylidene-4,5-bis(2-phenylethyl)oxolan-2-one.
Molecular Properties
| Compound Name | 3-methylidene-4,5-bis(2-phenylethyl)oxolan-2-one |
| PubChem CID | 118708712 |
| Molecular Formula | C21H22O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 3-methylidene-4,5-bis(2-phenylethyl)oxolan-2-one |
| SMILES | C=C1C(=O)OC(CCc2ccccc2)C1CCc1ccccc1 |
| InChI | InChI=1S/C21H22O2/c1-16-19(14-12-17-8-4-2-5-9-17)20(23-21(16)22)15-13-18-10-6-3-7-11-18/h2-11,19-20H,1,12-15H2 |
| InChIKey | RJPJTORCLPJVCS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methylidene-4,5-bis(2-phenylethyl)oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylidene-4,5-bis(2-phenylethyl)oxolan-2-one?
The IUPAC name of 3-methylidene-4,5-bis(2-phenylethyl)oxolan-2-one (CID 118708712) is 3-methylidene-4,5-bis(2-phenylethyl)oxolan-2-one.
What is the SMILES notation for 3-methylidene-4,5-bis(2-phenylethyl)oxolan-2-one?
The canonical SMILES for 3-methylidene-4,5-bis(2-phenylethyl)oxolan-2-one is C=C1C(=O)OC(CCc2ccccc2)C1CCc1ccccc1.
What is the InChIKey of 3-methylidene-4,5-bis(2-phenylethyl)oxolan-2-one?
The InChIKey is RJPJTORCLPJVCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22O2/c1-16-19(14-12-17-8-4-2-5-9-17)20(23-21(16)22)15-13-18-10-6-3-7-11-18/h2-11,19-20H,1,12-15H2.
What are the key properties of 3-methylidene-4,5-bis(2-phenylethyl)oxolan-2-one?
3-methylidene-4,5-bis(2-phenylethyl)oxolan-2-one has a molecular weight of 306.41 g/mol, XLogP of 4.35, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylidene-4,5-bis(2-phenylethyl)oxolan-2-one is sourced from PubChem (CID 118708712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).