C27H18N2O8 — CID 118708730
(5S,7S,9R)-7,9-bis(1-nitronaphthalen-2-yl)-1,8,10-trioxaspiro[4.5]dec-3-en-2-one (PubChem CID 118708730) has the molecular formula C27H18N2O8 and a molecular weight of 498.45 g/mol. Its IUPAC name is (5S,7S,9R)-7,9-bis(1-nitronaphthalen-2-yl)-1,8,10-trioxaspiro[4.5]dec-3-en-2-one.
| Compound Name | (5S,7S,9R)-7,9-bis(1-nitronaphthalen-2-yl)-1,8,10-trioxaspiro[4.5]dec-3-en-2-one |
|---|---|
| PubChem CID | 118708730 |
| Molecular Formula | C27H18N2O8 |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | (5S,7S,9R)-7,9-bis(1-nitronaphthalen-2-yl)-1,8,10-trioxaspiro[4.5]dec-3-en-2-one |
| SMILES | O=C1C=C[C@]2(C[C@@H](c3ccc4ccccc4c3[N+](=O)[O-])O[C@@H](c3ccc4ccccc4c3[N+](=O)[O-])O2)O1 |
| InChI | InChI=1S/C27H18N2O8/c30-23-13-14-27(36-23)15-22(20-11-9-16-5-1-3-7-18(16)24(20)28(31)32)35-26(37-27)21-12-10-17-6-2-4-8-19(17)25(21)29(33)34/h1-14,22,26H,15H2/t22-,26+,27-/m0/s1 |
| InChIKey | WBFGANMWJPVKFB-FDJWOJMMSA-N |
| XLogP | 5.80 |
| TPSA | 131.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|