C21H13BrCl2N2O4S2 — CID 118709117
3-[(5Z)-5-[5-bromo-1-[(2,6-dichlorophenyl)methyl]-3-oxoindol-2-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid (PubChem CID 118709117) has the molecular formula C21H13BrCl2N2O4S2 and a molecular weight of 572.29 g/mol. Its IUPAC name is 3-[(5Z)-5-[5-bromo-1-[(2,6-dichlorophenyl)methyl]-3-oxoindol-2-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid.
| Compound Name | 3-[(5Z)-5-[5-bromo-1-[(2,6-dichlorophenyl)methyl]-3-oxoindol-2-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 118709117 |
| Molecular Formula | C21H13BrCl2N2O4S2 |
| Molecular Weight | 572.29 g/mol |
| Exact Mass | 569.89 |
| IUPAC Name | 3-[(5Z)-5-[5-bromo-1-[(2,6-dichlorophenyl)methyl]-3-oxoindol-2-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)/C(=C2\C(=O)c3cc(Br)ccc3N2Cc2c(Cl)cccc2Cl)SC1=S |
| InChI | InChI=1S/C21H13BrCl2N2O4S2/c22-10-4-5-15-11(8-10)18(29)17(26(15)9-12-13(23)2-1-3-14(12)24)19-20(30)25(21(31)32-19)7-6-16(27)28/h1-5,8H,6-7,9H2,(H,27,28)/b19-17- |
| InChIKey | OAAXGKJGVYYYHB-ZPHPHTNESA-N |
| XLogP | 5.51 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.29 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|