C9H15NO — CID 118709205
(6S,7aS)-1-methyl-2,3,5,6,7,7a-hexahydroindol-6-ol (PubChem CID 118709205) has the molecular formula C9H15NO and a molecular weight of 153.23 g/mol. Its IUPAC name is (6S,7aS)-1-methyl-2,3,5,6,7,7a-hexahydroindol-6-ol.
| Compound Name | (6S,7aS)-1-methyl-2,3,5,6,7,7a-hexahydroindol-6-ol |
|---|---|
| PubChem CID | 118709205 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (6S,7aS)-1-methyl-2,3,5,6,7,7a-hexahydroindol-6-ol |
| SMILES | CN1CCC2=CC[C@H](O)C[C@@H]21 |
| InChI | InChI=1S/C9H15NO/c1-10-5-4-7-2-3-8(11)6-9(7)10/h2,8-9,11H,3-6H2,1H3/t8-,9-/m0/s1 |
| InChIKey | AKIJFXULDFXJQR-IUCAKERBSA-N |
| XLogP | 0.77 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|