C9H15NO — CID 118709210
(6S,7aS)-6-methoxy-2,3,5,6,7,7a-hexahydro-1H-indole (PubChem CID 118709210) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is (6S,7aS)-6-methoxy-2,3,5,6,7,7a-hexahydro-1H-indole.
| Compound Name | (6S,7aS)-6-methoxy-2,3,5,6,7,7a-hexahydro-1H-indole |
|---|---|
| PubChem CID | 118709210 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (6S,7aS)-6-methoxy-2,3,5,6,7,7a-hexahydro-1H-indole |
| SMILES | CO[C@H]1CC=C2CCN[C@H]2C1 |
| InChI | InChI=1S/C9H15NO/c1-11-8-3-2-7-4-5-10-9(7)6-8/h2,8-10H,3-6H2,1H3/t8-,9-/m0/s1 |
| InChIKey | PSNWFVNLPKHQQL-IUCAKERBSA-N |
| XLogP | 1.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|