C24H24Cl2N4O3 — CID 118709389
5-chloro-1-[2-[4-[(7-chloroquinolin-4-yl)amino]butylamino]-3-hydroxypropyl]indole-2,3-dione (PubChem CID 118709389) has the molecular formula C24H24Cl2N4O3 and a molecular weight of 487.39 g/mol. Its IUPAC name is 5-chloro-1-[2-[4-[(7-chloroquinolin-4-yl)amino]butylamino]-3-hydroxypropyl]indole-2,3-dione.
| Compound Name | 5-chloro-1-[2-[4-[(7-chloroquinolin-4-yl)amino]butylamino]-3-hydroxypropyl]indole-2,3-dione |
|---|---|
| PubChem CID | 118709389 |
| Molecular Formula | C24H24Cl2N4O3 |
| Molecular Weight | 487.39 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | 5-chloro-1-[2-[4-[(7-chloroquinolin-4-yl)amino]butylamino]-3-hydroxypropyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(CC(CO)NCCCCNc2ccnc3cc(Cl)ccc23)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C24H24Cl2N4O3/c25-15-4-6-22-19(11-15)23(32)24(33)30(22)13-17(14-31)27-8-1-2-9-28-20-7-10-29-21-12-16(26)3-5-18(20)21/h3-7,10-12,17,27,31H,1-2,8-9,13-14H2,(H,28,29) |
| InChIKey | HCHUKOXMVCJWNS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|