C13H9ClN6 — CID 118709402
7-[(2-chlorophenyl)methyl]-[1,2,4]triazolo[3,4-f]purine (PubChem CID 118709402) has the molecular formula C13H9ClN6 and a molecular weight of 284.71 g/mol. Its IUPAC name is 7-[(2-chlorophenyl)methyl]-[1,2,4]triazolo[3,4-f]purine.
| Compound Name | 7-[(2-chlorophenyl)methyl]-[1,2,4]triazolo[3,4-f]purine |
|---|---|
| PubChem CID | 118709402 |
| Molecular Formula | C13H9ClN6 |
| Molecular Weight | 284.71 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 7-[(2-chlorophenyl)methyl]-[1,2,4]triazolo[3,4-f]purine |
| SMILES | Clc1ccccc1Cn1cnc2c1ncn1cnnc21 |
| InChI | InChI=1S/C13H9ClN6/c14-10-4-2-1-3-9(10)5-19-6-15-11-12(19)16-7-20-8-17-18-13(11)20/h1-4,6-8H,5H2 |
| InChIKey | DWRIQOVVGRPEKV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.71 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |