About 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-N-ethylpyridin-2-amine
4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-N-ethylpyridin-2-amine (PubChem CID 118709511) has the molecular formula C16H14ClN3S
and a molecular weight of 315.83 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-N-ethylpyridin-2-amine.
Molecular Properties
| Compound Name | 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-N-ethylpyridin-2-amine |
| PubChem CID | 118709511 |
| Molecular Formula | C16H14ClN3S |
| Molecular Weight | 315.83 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-N-ethylpyridin-2-amine |
| SMILES | CCNc1cc(-c2nc(-c3ccc(Cl)cc3)cs2)ccn1 |
| InChI | InChI=1S/C16H14ClN3S/c1-2-18-15-9-12(7-8-19-15)16-20-14(10-21-16)11-3-5-13(17)6-4-11/h3-10H,2H2,1H3,(H,18,19) |
| InChIKey | CMUQXFFWYNXWLO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.83 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-N-ethylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-N-ethylpyridin-2-amine?
The IUPAC name of 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-N-ethylpyridin-2-amine (CID 118709511) is 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-N-ethylpyridin-2-amine.
What is the SMILES notation for 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-N-ethylpyridin-2-amine?
The canonical SMILES for 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-N-ethylpyridin-2-amine is CCNc1cc(-c2nc(-c3ccc(Cl)cc3)cs2)ccn1.
What is the InChIKey of 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-N-ethylpyridin-2-amine?
The InChIKey is CMUQXFFWYNXWLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClN3S/c1-2-18-15-9-12(7-8-19-15)16-20-14(10-21-16)11-3-5-13(17)6-4-11/h3-10H,2H2,1H3,(H,18,19).
What are the key properties of 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-N-ethylpyridin-2-amine?
4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-N-ethylpyridin-2-amine has a molecular weight of 315.83 g/mol, XLogP of 4.96, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-N-ethylpyridin-2-amine is sourced from PubChem (CID 118709511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).