C18H16ClN3OS — CID 118709539
4-(4-chlorophenyl)-2-(2-propyl-4-pyridinyl)-1,3-thiazole-5-carboxamide (PubChem CID 118709539) has the molecular formula C18H16ClN3OS and a molecular weight of 357.87 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-(2-propyl-4-pyridinyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-(4-chlorophenyl)-2-(2-propyl-4-pyridinyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 118709539 |
| Molecular Formula | C18H16ClN3OS |
| Molecular Weight | 357.87 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 4-(4-chlorophenyl)-2-(2-propyl-4-pyridinyl)-1,3-thiazole-5-carboxamide |
| SMILES | CCCc1cc(-c2nc(-c3ccc(Cl)cc3)c(C(N)=O)s2)ccn1 |
| InChI | InChI=1S/C18H16ClN3OS/c1-2-3-14-10-12(8-9-21-14)18-22-15(16(24-18)17(20)23)11-4-6-13(19)7-5-11/h4-10H,2-3H2,1H3,(H2,20,23) |
| InChIKey | YFUDCDUIECSPRU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.87 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |