About 3-(3,4-dimethoxyphenyl)-5-(4-methylphenyl)-1H-pyrrolo[2,3-b]pyridine
3-(3,4-dimethoxyphenyl)-5-(4-methylphenyl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 118709550) has the molecular formula C22H20N2O2
and a molecular weight of 344.41 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-5-(4-methylphenyl)-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 3-(3,4-dimethoxyphenyl)-5-(4-methylphenyl)-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 118709550 |
| Molecular Formula | C22H20N2O2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-5-(4-methylphenyl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | COc1ccc(-c2c[nH]c3ncc(-c4ccc(C)cc4)cc23)cc1OC |
| InChI | InChI=1S/C22H20N2O2/c1-14-4-6-15(7-5-14)17-10-18-19(13-24-22(18)23-12-17)16-8-9-20(25-2)21(11-16)26-3/h4-13H,1-3H3,(H,23,24) |
| InChIKey | WSOTZUVCNVRMKZ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3,4-dimethoxyphenyl)-5-(4-methylphenyl)-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dimethoxyphenyl)-5-(4-methylphenyl)-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 3-(3,4-dimethoxyphenyl)-5-(4-methylphenyl)-1H-pyrrolo[2,3-b]pyridine (CID 118709550) is 3-(3,4-dimethoxyphenyl)-5-(4-methylphenyl)-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 3-(3,4-dimethoxyphenyl)-5-(4-methylphenyl)-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 3-(3,4-dimethoxyphenyl)-5-(4-methylphenyl)-1H-pyrrolo[2,3-b]pyridine is COc1ccc(-c2c[nH]c3ncc(-c4ccc(C)cc4)cc23)cc1OC.
What is the InChIKey of 3-(3,4-dimethoxyphenyl)-5-(4-methylphenyl)-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is WSOTZUVCNVRMKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N2O2/c1-14-4-6-15(7-5-14)17-10-18-19(13-24-22(18)23-12-17)16-8-9-20(25-2)21(11-16)26-3/h4-13H,1-3H3,(H,23,24).
What are the key properties of 3-(3,4-dimethoxyphenyl)-5-(4-methylphenyl)-1H-pyrrolo[2,3-b]pyridine?
3-(3,4-dimethoxyphenyl)-5-(4-methylphenyl)-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 344.41 g/mol, XLogP of 5.22, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dimethoxyphenyl)-5-(4-methylphenyl)-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 118709550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).