C22H21N3O3 — CID 118709553
3-[3-(3,4,5-trimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]aniline (PubChem CID 118709553) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is 3-[3-(3,4,5-trimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]aniline.
| Compound Name | 3-[3-(3,4,5-trimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]aniline |
|---|---|
| PubChem CID | 118709553 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 3-[3-(3,4,5-trimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]aniline |
| SMILES | COc1cc(-c2c[nH]c3ncc(-c4cccc(N)c4)cc23)cc(OC)c1OC |
| InChI | InChI=1S/C22H21N3O3/c1-26-19-9-14(10-20(27-2)21(19)28-3)18-12-25-22-17(18)8-15(11-24-22)13-5-4-6-16(23)7-13/h4-12H,23H2,1-3H3,(H,24,25) |
| InChIKey | WGQXLVAAFQPTJC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|