C27H30N4O4 — CID 118709571
5-[3-(3,4-dimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-2-(2-morpholin-4-ylethoxy)aniline (PubChem CID 118709571) has the molecular formula C27H30N4O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is 5-[3-(3,4-dimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-2-(2-morpholin-4-ylethoxy)aniline.
| Compound Name | 5-[3-(3,4-dimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-2-(2-morpholin-4-ylethoxy)aniline |
|---|---|
| PubChem CID | 118709571 |
| Molecular Formula | C27H30N4O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 5-[3-(3,4-dimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-2-(2-morpholin-4-ylethoxy)aniline |
| SMILES | COc1ccc(-c2c[nH]c3ncc(-c4ccc(OCCN5CCOCC5)c(N)c4)cc23)cc1OC |
| InChI | InChI=1S/C27H30N4O4/c1-32-25-6-4-19(15-26(25)33-2)22-17-30-27-21(22)13-20(16-29-27)18-3-5-24(23(28)14-18)35-12-9-31-7-10-34-11-8-31/h3-6,13-17H,7-12,28H2,1-2H3,(H,29,30) |
| InChIKey | MHVCXKBHHRUDTF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 94.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|