C19H29NO4 — CID 118709596
(1S,2R,4R,9R,11S,12R)-9-hydroxy-4,8-dimethyl-12-(pyrrolidin-1-ylmethyl)-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one (PubChem CID 118709596) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is (1S,2R,4R,9R,11S,12R)-9-hydroxy-4,8-dimethyl-12-(pyrrolidin-1-ylmethyl)-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one.
| Compound Name | (1S,2R,4R,9R,11S,12R)-9-hydroxy-4,8-dimethyl-12-(pyrrolidin-1-ylmethyl)-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one |
|---|---|
| PubChem CID | 118709596 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | (1S,2R,4R,9R,11S,12R)-9-hydroxy-4,8-dimethyl-12-(pyrrolidin-1-ylmethyl)-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one |
| SMILES | CC1=CCC[C@@]2(C)O[C@@H]2[C@H]2OC(=O)[C@@H](CN3CCCC3)[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C19H29NO4/c1-12-6-5-7-19(2)17(24-19)16-13(10-15(12)21)14(18(22)23-16)11-20-8-3-4-9-20/h6,13-17,21H,3-5,7-11H2,1-2H3/t13-,14-,15+,16-,17+,19+/m0/s1 |
| InChIKey | JYDLHDBFEPZUPQ-AMQNGPJSSA-N |
| XLogP | 1.89 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|