C26H33N3O2 — CID 11870962
4-[4-[[(3S,3aR,4aR,8aR,9aR)-8a-methyl-5-methylidene-2-oxo-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-3-yl]methyl]piperazin-1-yl]benzonitrile (PubChem CID 11870962) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is 4-[4-[[(3S,3aR,4aR,8aR,9aR)-8a-methyl-5-methylidene-2-oxo-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-3-yl]methyl]piperazin-1-yl]benzonitrile.
| Compound Name | 4-[4-[[(3S,3aR,4aR,8aR,9aR)-8a-methyl-5-methylidene-2-oxo-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-3-yl]methyl]piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 11870962 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | 4-[4-[[(3S,3aR,4aR,8aR,9aR)-8a-methyl-5-methylidene-2-oxo-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-3-yl]methyl]piperazin-1-yl]benzonitrile |
| SMILES | C=C1CCC[C@]2(C)C[C@H]3OC(=O)[C@H](CN4CCN(c5ccc(C#N)cc5)CC4)[C@H]3C[C@H]12 |
| InChI | InChI=1S/C26H33N3O2/c1-18-4-3-9-26(2)15-24-21(14-23(18)26)22(25(30)31-24)17-28-10-12-29(13-11-28)20-7-5-19(16-27)6-8-20/h5-8,21-24H,1,3-4,9-15,17H2,2H3/t21-,22-,23-,24-,26-/m1/s1 |
| InChIKey | NMKXSEUZYRAJBJ-CFXNPWLASA-N |
| XLogP | 3.99 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|