C22H19F3N6O3S — CID 118709856
1-ethyl-3-[7-pyridin-2-yl-5-[2-[(1R,2R)-3,3,3-trifluoro-1,2-dihydroxypropyl]pyrimidin-5-yl]-1,3-benzothiazol-2-yl]urea (PubChem CID 118709856) has the molecular formula C22H19F3N6O3S and a molecular weight of 504.49 g/mol. Its IUPAC name is 1-ethyl-3-[7-pyridin-2-yl-5-[2-[(1R,2R)-3,3,3-trifluoro-1,2-dihydroxypropyl]pyrimidin-5-yl]-1,3-benzothiazol-2-yl]urea.
| Compound Name | 1-ethyl-3-[7-pyridin-2-yl-5-[2-[(1R,2R)-3,3,3-trifluoro-1,2-dihydroxypropyl]pyrimidin-5-yl]-1,3-benzothiazol-2-yl]urea |
|---|---|
| PubChem CID | 118709856 |
| Molecular Formula | C22H19F3N6O3S |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | 1-ethyl-3-[7-pyridin-2-yl-5-[2-[(1R,2R)-3,3,3-trifluoro-1,2-dihydroxypropyl]pyrimidin-5-yl]-1,3-benzothiazol-2-yl]urea |
| SMILES | CCNC(=O)Nc1nc2cc(-c3cnc([C@@H](O)[C@@H](O)C(F)(F)F)nc3)cc(-c3ccccn3)c2s1 |
| InChI | InChI=1S/C22H19F3N6O3S/c1-2-26-20(34)31-21-30-15-8-11(7-13(17(15)35-21)14-5-3-4-6-27-14)12-9-28-19(29-10-12)16(32)18(33)22(23,24)25/h3-10,16,18,32-33H,2H2,1H3,(H2,26,30,31,34)/t16-,18+/m0/s1 |
| InChIKey | HICIUAOWQVGRSI-FUHWJXTLSA-N |
| XLogP | 3.91 |
| TPSA | 133.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |