C15H19NO6 — CID 118710031
(E)-3-phenyl-N-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]prop-2-enamide (PubChem CID 118710031) has the molecular formula C15H19NO6 and a molecular weight of 309.32 g/mol. Its IUPAC name is (E)-3-phenyl-N-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]prop-2-enamide.
| Compound Name | (E)-3-phenyl-N-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 118710031 |
| Molecular Formula | C15H19NO6 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | (E)-3-phenyl-N-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)N[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H19NO6/c17-8-10-12(19)13(20)14(21)15(22-10)16-11(18)7-6-9-4-2-1-3-5-9/h1-7,10,12-15,17,19-21H,8H2,(H,16,18)/b7-6+/t10-,12-,13+,14-,15-/m1/s1 |
| InChIKey | KIAHQWXLSODJCX-QHAFYCPUSA-N |
| XLogP | -1.38 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|