C21H25NO6 — CID 118710040
trans-(1S,2R)-2-methyl-1-naphthalen-1-yl-N-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]cyclopropane-1-carboxamide (PubChem CID 118710040) has the molecular formula C21H25NO6 and a molecular weight of 387.43 g/mol. Its IUPAC name is trans-(1S,2R)-2-methyl-1-naphthalen-1-yl-N-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]cyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2R)-2-methyl-1-naphthalen-1-yl-N-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 118710040 |
| Molecular Formula | C21H25NO6 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | trans-(1S,2R)-2-methyl-1-naphthalen-1-yl-N-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]cyclopropane-1-carboxamide |
| SMILES | C[C@@H]1C[C@@]1(C(=O)N[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)c1cccc2ccccc12 |
| InChI | InChI=1S/C21H25NO6/c1-11-9-21(11,14-8-4-6-12-5-2-3-7-13(12)14)20(27)22-19-18(26)17(25)16(24)15(10-23)28-19/h2-8,11,15-19,23-26H,9-10H2,1H3,(H,22,27)/t11-,15-,16-,17+,18-,19-,21+/m1/s1 |
| InChIKey | TVXVBIYSBDOUFP-FENAYWNPSA-N |
| XLogP | 0.03 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |