C19H29NO6 — CID 118710048
(3R)-3-(3,4-dimethylphenyl)-N-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]pentanamide (PubChem CID 118710048) has the molecular formula C19H29NO6 and a molecular weight of 367.44 g/mol. Its IUPAC name is (3R)-3-(3,4-dimethylphenyl)-N-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]pentanamide.
| Compound Name | (3R)-3-(3,4-dimethylphenyl)-N-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]pentanamide |
|---|---|
| PubChem CID | 118710048 |
| Molecular Formula | C19H29NO6 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | (3R)-3-(3,4-dimethylphenyl)-N-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]pentanamide |
| SMILES | CCC(CC(=O)N[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C19H29NO6/c1-4-12(13-6-5-10(2)11(3)7-13)8-15(22)20-19-18(25)17(24)16(23)14(9-21)26-19/h5-7,12,14,16-19,21,23-25H,4,8-9H2,1-3H3,(H,20,22)/t12?,14-,16-,17+,18-,19-/m1/s1 |
| InChIKey | JWFQURICDKDWGE-JAEGGOAQSA-N |
| XLogP | 0.10 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |