About 2-(4-chlorophenyl)-1-(4-methylsulfonylphenyl)-4,5-dihydroimidazole
2-(4-chlorophenyl)-1-(4-methylsulfonylphenyl)-4,5-dihydroimidazole (PubChem CID 118710094) has the molecular formula C16H15ClN2O2S
and a molecular weight of 334.83 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-(4-methylsulfonylphenyl)-4,5-dihydroimidazole.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-1-(4-methylsulfonylphenyl)-4,5-dihydroimidazole |
| PubChem CID | 118710094 |
| Molecular Formula | C16H15ClN2O2S |
| Molecular Weight | 334.83 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 2-(4-chlorophenyl)-1-(4-methylsulfonylphenyl)-4,5-dihydroimidazole |
| SMILES | CS(=O)(=O)c1ccc(N2CCN=C2c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H15ClN2O2S/c1-22(20,21)15-8-6-14(7-9-15)19-11-10-18-16(19)12-2-4-13(17)5-3-12/h2-9H,10-11H2,1H3 |
| InChIKey | SZNZPUJIPGZIKW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.83 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-chlorophenyl)-1-(4-methylsulfonylphenyl)-4,5-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-1-(4-methylsulfonylphenyl)-4,5-dihydroimidazole?
The IUPAC name of 2-(4-chlorophenyl)-1-(4-methylsulfonylphenyl)-4,5-dihydroimidazole (CID 118710094) is 2-(4-chlorophenyl)-1-(4-methylsulfonylphenyl)-4,5-dihydroimidazole.
What is the SMILES notation for 2-(4-chlorophenyl)-1-(4-methylsulfonylphenyl)-4,5-dihydroimidazole?
The canonical SMILES for 2-(4-chlorophenyl)-1-(4-methylsulfonylphenyl)-4,5-dihydroimidazole is CS(=O)(=O)c1ccc(N2CCN=C2c2ccc(Cl)cc2)cc1.
What is the InChIKey of 2-(4-chlorophenyl)-1-(4-methylsulfonylphenyl)-4,5-dihydroimidazole?
The InChIKey is SZNZPUJIPGZIKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClN2O2S/c1-22(20,21)15-8-6-14(7-9-15)19-11-10-18-16(19)12-2-4-13(17)5-3-12/h2-9H,10-11H2,1H3.
What are the key properties of 2-(4-chlorophenyl)-1-(4-methylsulfonylphenyl)-4,5-dihydroimidazole?
2-(4-chlorophenyl)-1-(4-methylsulfonylphenyl)-4,5-dihydroimidazole has a molecular weight of 334.83 g/mol, XLogP of 3.01, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-1-(4-methylsulfonylphenyl)-4,5-dihydroimidazole is sourced from PubChem (CID 118710094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).