About 4-[2-(4-fluorophenyl)-4,5-dihydroimidazol-1-yl]benzenesulfonamide
4-[2-(4-fluorophenyl)-4,5-dihydroimidazol-1-yl]benzenesulfonamide (PubChem CID 118710106) has the molecular formula C15H14FN3O2S
and a molecular weight of 319.36 g/mol. Its IUPAC name is 4-[2-(4-fluorophenyl)-4,5-dihydroimidazol-1-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[2-(4-fluorophenyl)-4,5-dihydroimidazol-1-yl]benzenesulfonamide |
| PubChem CID | 118710106 |
| Molecular Formula | C15H14FN3O2S |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 4-[2-(4-fluorophenyl)-4,5-dihydroimidazol-1-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N2CCN=C2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C15H14FN3O2S/c16-12-3-1-11(2-4-12)15-18-9-10-19(15)13-5-7-14(8-6-13)22(17,20)21/h1-8H,9-10H2,(H2,17,20,21) |
| InChIKey | JGUIZDSDTXOOHV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-(4-fluorophenyl)-4,5-dihydroimidazol-1-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(4-fluorophenyl)-4,5-dihydroimidazol-1-yl]benzenesulfonamide?
The IUPAC name of 4-[2-(4-fluorophenyl)-4,5-dihydroimidazol-1-yl]benzenesulfonamide (CID 118710106) is 4-[2-(4-fluorophenyl)-4,5-dihydroimidazol-1-yl]benzenesulfonamide.
What is the SMILES notation for 4-[2-(4-fluorophenyl)-4,5-dihydroimidazol-1-yl]benzenesulfonamide?
The canonical SMILES for 4-[2-(4-fluorophenyl)-4,5-dihydroimidazol-1-yl]benzenesulfonamide is NS(=O)(=O)c1ccc(N2CCN=C2c2ccc(F)cc2)cc1.
What is the InChIKey of 4-[2-(4-fluorophenyl)-4,5-dihydroimidazol-1-yl]benzenesulfonamide?
The InChIKey is JGUIZDSDTXOOHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14FN3O2S/c16-12-3-1-11(2-4-12)15-18-9-10-19(15)13-5-7-14(8-6-13)22(17,20)21/h1-8H,9-10H2,(H2,17,20,21).
What are the key properties of 4-[2-(4-fluorophenyl)-4,5-dihydroimidazol-1-yl]benzenesulfonamide?
4-[2-(4-fluorophenyl)-4,5-dihydroimidazol-1-yl]benzenesulfonamide has a molecular weight of 319.36 g/mol, XLogP of 1.74, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(4-fluorophenyl)-4,5-dihydroimidazol-1-yl]benzenesulfonamide is sourced from PubChem (CID 118710106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).