About 3-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butylsulfamoyl]benzoic acid
3-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butylsulfamoyl]benzoic acid (PubChem CID 118710195) has the molecular formula C23H20N2O6S
and a molecular weight of 452.49 g/mol. Its IUPAC name is 3-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butylsulfamoyl]benzoic acid.
Molecular Properties
| Compound Name | 3-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butylsulfamoyl]benzoic acid |
| PubChem CID | 118710195 |
| Molecular Formula | C23H20N2O6S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 3-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butylsulfamoyl]benzoic acid |
| SMILES | O=C(O)c1cccc(S(=O)(=O)NCCCCN2C(=O)c3cccc4cccc(c34)C2=O)c1 |
| InChI | InChI=1S/C23H20N2O6S/c26-21-18-10-4-6-15-7-5-11-19(20(15)18)22(27)25(21)13-2-1-12-24-32(30,31)17-9-3-8-16(14-17)23(28)29/h3-11,14,24H,1-2,12-13H2,(H,28,29) |
| InChIKey | KUNDLECGYTVOQE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butylsulfamoyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butylsulfamoyl]benzoic acid?
The IUPAC name of 3-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butylsulfamoyl]benzoic acid (CID 118710195) is 3-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butylsulfamoyl]benzoic acid.
What is the SMILES notation for 3-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butylsulfamoyl]benzoic acid?
The canonical SMILES for 3-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butylsulfamoyl]benzoic acid is O=C(O)c1cccc(S(=O)(=O)NCCCCN2C(=O)c3cccc4cccc(c34)C2=O)c1.
What is the InChIKey of 3-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butylsulfamoyl]benzoic acid?
The InChIKey is KUNDLECGYTVOQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N2O6S/c26-21-18-10-4-6-15-7-5-11-19(20(15)18)22(27)25(21)13-2-1-12-24-32(30,31)17-9-3-8-16(14-17)23(28)29/h3-11,14,24H,1-2,12-13H2,(H,28,29).
What are the key properties of 3-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butylsulfamoyl]benzoic acid?
3-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butylsulfamoyl]benzoic acid has a molecular weight of 452.49 g/mol, XLogP of 2.89, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butylsulfamoyl]benzoic acid is sourced from PubChem (CID 118710195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).