About 6-methyl-2,2-dioxo-3-phenacyloxathiazin-4-one
6-methyl-2,2-dioxo-3-phenacyloxathiazin-4-one (PubChem CID 118710201) has the molecular formula C12H11NO5S
and a molecular weight of 281.29 g/mol. Its IUPAC name is 6-methyl-2,2-dioxo-3-phenacyloxathiazin-4-one.
Molecular Properties
| Compound Name | 6-methyl-2,2-dioxo-3-phenacyloxathiazin-4-one |
| PubChem CID | 118710201 |
| Molecular Formula | C12H11NO5S |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 6-methyl-2,2-dioxo-3-phenacyloxathiazin-4-one |
| SMILES | CC1=CC(=O)N(CC(=O)c2ccccc2)S(=O)(=O)O1 |
| InChI | InChI=1S/C12H11NO5S/c1-9-7-12(15)13(19(16,17)18-9)8-11(14)10-5-3-2-4-6-10/h2-7H,8H2,1H3 |
| InChIKey | FATGRSGTHGRNLV-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-methyl-2,2-dioxo-3-phenacyloxathiazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2,2-dioxo-3-phenacyloxathiazin-4-one?
The IUPAC name of 6-methyl-2,2-dioxo-3-phenacyloxathiazin-4-one (CID 118710201) is 6-methyl-2,2-dioxo-3-phenacyloxathiazin-4-one.
What is the SMILES notation for 6-methyl-2,2-dioxo-3-phenacyloxathiazin-4-one?
The canonical SMILES for 6-methyl-2,2-dioxo-3-phenacyloxathiazin-4-one is CC1=CC(=O)N(CC(=O)c2ccccc2)S(=O)(=O)O1.
What is the InChIKey of 6-methyl-2,2-dioxo-3-phenacyloxathiazin-4-one?
The InChIKey is FATGRSGTHGRNLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO5S/c1-9-7-12(15)13(19(16,17)18-9)8-11(14)10-5-3-2-4-6-10/h2-7H,8H2,1H3.
What are the key properties of 6-methyl-2,2-dioxo-3-phenacyloxathiazin-4-one?
6-methyl-2,2-dioxo-3-phenacyloxathiazin-4-one has a molecular weight of 281.29 g/mol, XLogP of 0.88, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2,2-dioxo-3-phenacyloxathiazin-4-one is sourced from PubChem (CID 118710201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).