C21H21N3O3 — CID 118710272
6-[(E)-3-oxo-3-[3-(phenoxymethyl)azetidin-1-yl]prop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one (PubChem CID 118710272) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is 6-[(E)-3-oxo-3-[3-(phenoxymethyl)azetidin-1-yl]prop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one.
| Compound Name | 6-[(E)-3-oxo-3-[3-(phenoxymethyl)azetidin-1-yl]prop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 118710272 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 6-[(E)-3-oxo-3-[3-(phenoxymethyl)azetidin-1-yl]prop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
| SMILES | O=C1CCc2cc(/C=C/C(=O)N3CC(COc4ccccc4)C3)cnc2N1 |
| InChI | InChI=1S/C21H21N3O3/c25-19-8-7-17-10-15(11-22-21(17)23-19)6-9-20(26)24-12-16(13-24)14-27-18-4-2-1-3-5-18/h1-6,9-11,16H,7-8,12-14H2,(H,22,23,25)/b9-6+ |
| InChIKey | UVJLFLCCLXYDAU-RMKNXTFCSA-N |
| XLogP | 2.52 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|