C19H18N4O2 — CID 118710287
6-[(E)-3-oxo-3-(3-pyridin-2-ylazetidin-1-yl)prop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one (PubChem CID 118710287) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is 6-[(E)-3-oxo-3-(3-pyridin-2-ylazetidin-1-yl)prop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one.
| Compound Name | 6-[(E)-3-oxo-3-(3-pyridin-2-ylazetidin-1-yl)prop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 118710287 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 6-[(E)-3-oxo-3-(3-pyridin-2-ylazetidin-1-yl)prop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
| SMILES | O=C1CCc2cc(/C=C/C(=O)N3CC(c4ccccn4)C3)cnc2N1 |
| InChI | InChI=1S/C19H18N4O2/c24-17-6-5-14-9-13(10-21-19(14)22-17)4-7-18(25)23-11-15(12-23)16-3-1-2-8-20-16/h1-4,7-10,15H,5-6,11-12H2,(H,21,22,24)/b7-4+ |
| InChIKey | CLCRJHVGALVENL-QPJJXVBHSA-N |
| XLogP | 2.00 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|