C20H19N3O2 — CID 118710288
6-[(E)-3-oxo-3-(3-phenylazetidin-1-yl)prop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one (PubChem CID 118710288) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is 6-[(E)-3-oxo-3-(3-phenylazetidin-1-yl)prop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one.
| Compound Name | 6-[(E)-3-oxo-3-(3-phenylazetidin-1-yl)prop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 118710288 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 6-[(E)-3-oxo-3-(3-phenylazetidin-1-yl)prop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
| SMILES | O=C1CCc2cc(/C=C/C(=O)N3CC(c4ccccc4)C3)cnc2N1 |
| InChI | InChI=1S/C20H19N3O2/c24-18-8-7-16-10-14(11-21-20(16)22-18)6-9-19(25)23-12-17(13-23)15-4-2-1-3-5-15/h1-6,9-11,17H,7-8,12-13H2,(H,21,22,24)/b9-6+ |
| InChIKey | XWUDCBZHFRCBSR-RMKNXTFCSA-N |
| XLogP | 2.61 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|