About 4-[2-(4-tert-butylphenoxy)ethyl]-1,2-dihydroimidazo[1,2-a]benzimidazole
4-[2-(4-tert-butylphenoxy)ethyl]-1,2-dihydroimidazo[1,2-a]benzimidazole (PubChem CID 118710297) has the molecular formula C21H25N3O
and a molecular weight of 335.45 g/mol. Its IUPAC name is 4-[2-(4-tert-butylphenoxy)ethyl]-1,2-dihydroimidazo[1,2-a]benzimidazole.
Molecular Properties
| Compound Name | 4-[2-(4-tert-butylphenoxy)ethyl]-1,2-dihydroimidazo[1,2-a]benzimidazole |
| PubChem CID | 118710297 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 4-[2-(4-tert-butylphenoxy)ethyl]-1,2-dihydroimidazo[1,2-a]benzimidazole |
| SMILES | CC(C)(C)c1ccc(OCCN2C3=NCCN3c3ccccc32)cc1 |
| InChI | InChI=1S/C21H25N3O/c1-21(2,3)16-8-10-17(11-9-16)25-15-14-24-19-7-5-4-6-18(19)23-13-12-22-20(23)24/h4-11H,12-15H2,1-3H3 |
| InChIKey | VYUAOEKDDVVKON-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-(4-tert-butylphenoxy)ethyl]-1,2-dihydroimidazo[1,2-a]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(4-tert-butylphenoxy)ethyl]-1,2-dihydroimidazo[1,2-a]benzimidazole?
The IUPAC name of 4-[2-(4-tert-butylphenoxy)ethyl]-1,2-dihydroimidazo[1,2-a]benzimidazole (CID 118710297) is 4-[2-(4-tert-butylphenoxy)ethyl]-1,2-dihydroimidazo[1,2-a]benzimidazole.
What is the SMILES notation for 4-[2-(4-tert-butylphenoxy)ethyl]-1,2-dihydroimidazo[1,2-a]benzimidazole?
The canonical SMILES for 4-[2-(4-tert-butylphenoxy)ethyl]-1,2-dihydroimidazo[1,2-a]benzimidazole is CC(C)(C)c1ccc(OCCN2C3=NCCN3c3ccccc32)cc1.
What is the InChIKey of 4-[2-(4-tert-butylphenoxy)ethyl]-1,2-dihydroimidazo[1,2-a]benzimidazole?
The InChIKey is VYUAOEKDDVVKON-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N3O/c1-21(2,3)16-8-10-17(11-9-16)25-15-14-24-19-7-5-4-6-18(19)23-13-12-22-20(23)24/h4-11H,12-15H2,1-3H3.
What are the key properties of 4-[2-(4-tert-butylphenoxy)ethyl]-1,2-dihydroimidazo[1,2-a]benzimidazole?
4-[2-(4-tert-butylphenoxy)ethyl]-1,2-dihydroimidazo[1,2-a]benzimidazole has a molecular weight of 335.45 g/mol, XLogP of 4.06, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(4-tert-butylphenoxy)ethyl]-1,2-dihydroimidazo[1,2-a]benzimidazole is sourced from PubChem (CID 118710297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).