C25H28N2O5 — CID 118710399
(1R,4R,5S,7R)-3,4-dibenzyl-7-[(2S)-2-(hydroxymethyl)pyrrolidine-1-carbonyl]-6,8-dioxa-3-azabicyclo[3.2.1]octan-2-one (PubChem CID 118710399) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is (1R,4R,5S,7R)-3,4-dibenzyl-7-[(2S)-2-(hydroxymethyl)pyrrolidine-1-carbonyl]-6,8-dioxa-3-azabicyclo[3.2.1]octan-2-one.
| Compound Name | (1R,4R,5S,7R)-3,4-dibenzyl-7-[(2S)-2-(hydroxymethyl)pyrrolidine-1-carbonyl]-6,8-dioxa-3-azabicyclo[3.2.1]octan-2-one |
|---|---|
| PubChem CID | 118710399 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | (1R,4R,5S,7R)-3,4-dibenzyl-7-[(2S)-2-(hydroxymethyl)pyrrolidine-1-carbonyl]-6,8-dioxa-3-azabicyclo[3.2.1]octan-2-one |
| SMILES | O=C([C@@H]1O[C@@H]2O[C@H]1C(=O)N(Cc1ccccc1)[C@@H]2Cc1ccccc1)N1CCC[C@H]1CO |
| InChI | InChI=1S/C25H28N2O5/c28-16-19-12-7-13-26(19)23(29)21-22-24(30)27(15-18-10-5-2-6-11-18)20(25(31-21)32-22)14-17-8-3-1-4-9-17/h1-6,8-11,19-22,25,28H,7,12-16H2/t19-,20+,21+,22+,25+/m0/s1 |
| InChIKey | LSPWMZYUMSQQRQ-VUTAGKHMSA-N |
| XLogP | 1.73 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |