C25H34O6 — CID 118710438
(2S,4'aR,6S,8'aR)-2-[(1E,5R)-5-hydroperoxy-2,6-dimethylhepta-1,6-dienyl]-4'-(hydroxymethyl)-4,7'-dimethylspiro[2,3-dihydropyran-6,2'-5,8a-dihydro-4aH-chromene]-6'-one (PubChem CID 118710438) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is (2S,4'aR,6S,8'aR)-2-[(1E,5R)-5-hydroperoxy-2,6-dimethylhepta-1,6-dienyl]-4'-(hydroxymethyl)-4,7'-dimethylspiro[2,3-dihydropyran-6,2'-5,8a-dihydro-4aH-chromene]-6'-one.
| Compound Name | (2S,4'aR,6S,8'aR)-2-[(1E,5R)-5-hydroperoxy-2,6-dimethylhepta-1,6-dienyl]-4'-(hydroxymethyl)-4,7'-dimethylspiro[2,3-dihydropyran-6,2'-5,8a-dihydro-4aH-chromene]-6'-one |
|---|---|
| PubChem CID | 118710438 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | (2S,4'aR,6S,8'aR)-2-[(1E,5R)-5-hydroperoxy-2,6-dimethylhepta-1,6-dienyl]-4'-(hydroxymethyl)-4,7'-dimethylspiro[2,3-dihydropyran-6,2'-5,8a-dihydro-4aH-chromene]-6'-one |
| SMILES | C=C(C)[C@@H](CC/C(C)=C/[C@@H]1CC(C)=C[C@]2(C=C(CO)[C@H]3CC(=O)C(C)=C[C@H]3O2)O1)OO |
| InChI | InChI=1S/C25H34O6/c1-15(2)23(31-28)7-6-16(3)8-20-9-17(4)12-25(29-20)13-19(14-26)21-11-22(27)18(5)10-24(21)30-25/h8,10,12-13,20-21,23-24,26,28H,1,6-7,9,11,14H2,2-5H3/b16-8+/t20-,21-,23-,24-,25+/m1/s1 |
| InChIKey | AFCSVFPVLSEQQA-PHNSNYLUSA-N |
| XLogP | 4.43 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|