C22H25Cl2N5O — CID 118710459
N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]imidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 118710459) has the molecular formula C22H25Cl2N5O and a molecular weight of 446.38 g/mol. Its IUPAC name is N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]imidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]imidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 118710459 |
| Molecular Formula | C22H25Cl2N5O |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]imidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | O=C(NCCCCN1CCN(c2cccc(Cl)c2Cl)CC1)c1cn2ccccc2n1 |
| InChI | InChI=1S/C22H25Cl2N5O/c23-17-6-5-7-19(21(17)24)28-14-12-27(13-15-28)10-4-2-9-25-22(30)18-16-29-11-3-1-8-20(29)26-18/h1,3,5-8,11,16H,2,4,9-10,12-15H2,(H,25,30) |
| InChIKey | NOUYXTFEXJHBRE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 52.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|