C24H29N3O2 — CID 118710500
11-[3-(diethylamino)propoxy]-6,7-dihydro-5H-quinazolino[2,3-a][2]benzazepin-9-one (PubChem CID 118710500) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 11-[3-(diethylamino)propoxy]-6,7-dihydro-5H-quinazolino[2,3-a][2]benzazepin-9-one.
| Compound Name | 11-[3-(diethylamino)propoxy]-6,7-dihydro-5H-quinazolino[2,3-a][2]benzazepin-9-one |
|---|---|
| PubChem CID | 118710500 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 11-[3-(diethylamino)propoxy]-6,7-dihydro-5H-quinazolino[2,3-a][2]benzazepin-9-one |
| SMILES | CCN(CC)CCCOc1ccc2nc3n(c(=O)c2c1)CCCc1ccccc1-3 |
| InChI | InChI=1S/C24H29N3O2/c1-3-26(4-2)14-8-16-29-19-12-13-22-21(17-19)24(28)27-15-7-10-18-9-5-6-11-20(18)23(27)25-22/h5-6,9,11-13,17H,3-4,7-8,10,14-16H2,1-2H3 |
| InChIKey | GLVFHGWUKQPBOF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|