About 8-hydroxy-1-methyl-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-6-one
8-hydroxy-1-methyl-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-6-one (PubChem CID 118710730) has the molecular formula C12H13N3O2
and a molecular weight of 231.25 g/mol. Its IUPAC name is 8-hydroxy-1-methyl-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-6-one.
Molecular Properties
| Compound Name | 8-hydroxy-1-methyl-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-6-one |
| PubChem CID | 118710730 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 8-hydroxy-1-methyl-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-6-one |
| SMILES | CN1CCCn2c1nc1ccc(O)cc1c2=O |
| InChI | InChI=1S/C12H13N3O2/c1-14-5-2-6-15-11(17)9-7-8(16)3-4-10(9)13-12(14)15/h3-4,7,16H,2,5-6H2,1H3 |
| InChIKey | MYLZNHKQKHWXGY-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-hydroxy-1-methyl-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hydroxy-1-methyl-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-6-one?
The IUPAC name of 8-hydroxy-1-methyl-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-6-one (CID 118710730) is 8-hydroxy-1-methyl-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-6-one.
What is the SMILES notation for 8-hydroxy-1-methyl-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-6-one?
The canonical SMILES for 8-hydroxy-1-methyl-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-6-one is CN1CCCn2c1nc1ccc(O)cc1c2=O.
What is the InChIKey of 8-hydroxy-1-methyl-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-6-one?
The InChIKey is MYLZNHKQKHWXGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O2/c1-14-5-2-6-15-11(17)9-7-8(16)3-4-10(9)13-12(14)15/h3-4,7,16H,2,5-6H2,1H3.
What are the key properties of 8-hydroxy-1-methyl-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-6-one?
8-hydroxy-1-methyl-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-6-one has a molecular weight of 231.25 g/mol, XLogP of 0.94, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydroxy-1-methyl-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-6-one is sourced from PubChem (CID 118710730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).