About 1-benzyl-8-hydroxy-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-6-one
1-benzyl-8-hydroxy-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-6-one (PubChem CID 118710731) has the molecular formula C18H17N3O2
and a molecular weight of 307.35 g/mol. Its IUPAC name is 1-benzyl-8-hydroxy-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-6-one.
Molecular Properties
| Compound Name | 1-benzyl-8-hydroxy-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-6-one |
| PubChem CID | 118710731 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 1-benzyl-8-hydroxy-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-6-one |
| SMILES | O=c1c2cc(O)ccc2nc2n1CCCN2Cc1ccccc1 |
| InChI | InChI=1S/C18H17N3O2/c22-14-7-8-16-15(11-14)17(23)21-10-4-9-20(18(21)19-16)12-13-5-2-1-3-6-13/h1-3,5-8,11,22H,4,9-10,12H2 |
| InChIKey | HTXUDRKOBZBJTA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-benzyl-8-hydroxy-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-8-hydroxy-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-6-one?
The IUPAC name of 1-benzyl-8-hydroxy-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-6-one (CID 118710731) is 1-benzyl-8-hydroxy-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-6-one.
What is the SMILES notation for 1-benzyl-8-hydroxy-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-6-one?
The canonical SMILES for 1-benzyl-8-hydroxy-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-6-one is O=c1c2cc(O)ccc2nc2n1CCCN2Cc1ccccc1.
What is the InChIKey of 1-benzyl-8-hydroxy-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-6-one?
The InChIKey is HTXUDRKOBZBJTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O2/c22-14-7-8-16-15(11-14)17(23)21-10-4-9-20(18(21)19-16)12-13-5-2-1-3-6-13/h1-3,5-8,11,22H,4,9-10,12H2.
What are the key properties of 1-benzyl-8-hydroxy-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-6-one?
1-benzyl-8-hydroxy-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-6-one has a molecular weight of 307.35 g/mol, XLogP of 2.51, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-8-hydroxy-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-6-one is sourced from PubChem (CID 118710731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).